C21H31N5O2 — CID 146284630
(Z)-2-[(5S)-5-[5-amino-4-(2-methylpyrrolidine-1-carbonyl)imidazol-1-yl]-2-methylcyclohexen-1-yl]-3-(methylamino)but-2-enal (PubChem CID 146284630) has the molecular formula C21H31N5O2 and a molecular weight of 385.51 g/mol. Its IUPAC name is (Z)-2-[(5S)-5-[5-amino-4-(2-methylpyrrolidine-1-carbonyl)imidazol-1-yl]-2-methylcyclohexen-1-yl]-3-(methylamino)but-2-enal.
| Compound Name | (Z)-2-[(5S)-5-[5-amino-4-(2-methylpyrrolidine-1-carbonyl)imidazol-1-yl]-2-methylcyclohexen-1-yl]-3-(methylamino)but-2-enal |
|---|---|
| PubChem CID | 146284630 |
| Molecular Formula | C21H31N5O2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | (Z)-2-[(5S)-5-[5-amino-4-(2-methylpyrrolidine-1-carbonyl)imidazol-1-yl]-2-methylcyclohexen-1-yl]-3-(methylamino)but-2-enal |
| SMILES | CN/C(C)=C(\C=O)C1=C(C)CC[C@H](n2cnc(C(=O)N3CCCC3C)c2N)C1 |
| InChI | InChI=1S/C21H31N5O2/c1-13-7-8-16(10-17(13)18(11-27)15(3)23-4)26-12-24-19(20(26)22)21(28)25-9-5-6-14(25)2/h11-12,14,16,23H,5-10,22H2,1-4H3/b18-15+/t14?,16-/m0/s1 |
| InChIKey | QQNLOJPDXMPVKY-SBZXHKFXSA-N |
| XLogP | 2.82 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|