C17H21BrN2O3 — CID 146286758
ethyl 1-(4-bromo-2-methoxyphenyl)-2-(2-methylpropyl)imidazole-4-carboxylate (PubChem CID 146286758) has the molecular formula C17H21BrN2O3 and a molecular weight of 381.27 g/mol. Its IUPAC name is ethyl 1-(4-bromo-2-methoxyphenyl)-2-(2-methylpropyl)imidazole-4-carboxylate.
| Compound Name | ethyl 1-(4-bromo-2-methoxyphenyl)-2-(2-methylpropyl)imidazole-4-carboxylate |
|---|---|
| PubChem CID | 146286758 |
| Molecular Formula | C17H21BrN2O3 |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | ethyl 1-(4-bromo-2-methoxyphenyl)-2-(2-methylpropyl)imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2ccc(Br)cc2OC)c(CC(C)C)n1 |
| InChI | InChI=1S/C17H21BrN2O3/c1-5-23-17(21)13-10-20(16(19-13)8-11(2)3)14-7-6-12(18)9-15(14)22-4/h6-7,9-11H,5,8H2,1-4H3 |
| InChIKey | IAAPULFJCWKTNI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |