C14H15Br2N3O2 — CID 63465967
ethyl 5-amino-1-(2,4-dibromophenyl)-2-ethylimidazole-4-carboxylate (PubChem CID 63465967) has the molecular formula C14H15Br2N3O2 and a molecular weight of 417.10 g/mol. Its IUPAC name is ethyl 5-amino-1-(2,4-dibromophenyl)-2-ethylimidazole-4-carboxylate.
| Compound Name | ethyl 5-amino-1-(2,4-dibromophenyl)-2-ethylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 63465967 |
| Molecular Formula | C14H15Br2N3O2 |
| Molecular Weight | 417.10 g/mol |
| Exact Mass | 414.95 |
| IUPAC Name | ethyl 5-amino-1-(2,4-dibromophenyl)-2-ethylimidazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(CC)n(-c2ccc(Br)cc2Br)c1N |
| InChI | InChI=1S/C14H15Br2N3O2/c1-3-11-18-12(14(20)21-4-2)13(17)19(11)10-6-5-8(15)7-9(10)16/h5-7H,3-4,17H2,1-2H3 |
| InChIKey | YUMWCWZLJBKCLH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.10 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |