C15H13Br2N3 — CID 63495969
1-(2,4-dibromophenyl)-2-ethylbenzimidazol-5-amine (PubChem CID 63495969) has the molecular formula C15H13Br2N3 and a molecular weight of 395.10 g/mol. Its IUPAC name is 1-(2,4-dibromophenyl)-2-ethylbenzimidazol-5-amine.
| Compound Name | 1-(2,4-dibromophenyl)-2-ethylbenzimidazol-5-amine |
|---|---|
| PubChem CID | 63495969 |
| Molecular Formula | C15H13Br2N3 |
| Molecular Weight | 395.10 g/mol |
| Exact Mass | 392.95 |
| IUPAC Name | 1-(2,4-dibromophenyl)-2-ethylbenzimidazol-5-amine |
| SMILES | CCc1nc2cc(N)ccc2n1-c1ccc(Br)cc1Br |
| InChI | InChI=1S/C15H13Br2N3/c1-2-15-19-12-8-10(18)4-6-14(12)20(15)13-5-3-9(16)7-11(13)17/h3-8H,2,18H2,1H3 |
| InChIKey | MZVZRLAPZVWWJF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.10 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|