C15H12Cl2FN3 — CID 83072700
1-(2,6-dichloro-4-fluorophenyl)-2-ethylbenzimidazol-5-amine (PubChem CID 83072700) has the molecular formula C15H12Cl2FN3 and a molecular weight of 324.19 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-fluorophenyl)-2-ethylbenzimidazol-5-amine.
| Compound Name | 1-(2,6-dichloro-4-fluorophenyl)-2-ethylbenzimidazol-5-amine |
|---|---|
| PubChem CID | 83072700 |
| Molecular Formula | C15H12Cl2FN3 |
| Molecular Weight | 324.19 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 1-(2,6-dichloro-4-fluorophenyl)-2-ethylbenzimidazol-5-amine |
| SMILES | CCc1nc2cc(N)ccc2n1-c1c(Cl)cc(F)cc1Cl |
| InChI | InChI=1S/C15H12Cl2FN3/c1-2-14-20-12-7-9(19)3-4-13(12)21(14)15-10(16)5-8(18)6-11(15)17/h3-7H,2,19H2,1H3 |
| InChIKey | OTKIEPZJOHFYEA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.19 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|