C16H16BrN3O — CID 65499669
[5-amino-1-(4-bromo-2,6-dimethylphenyl)benzimidazol-2-yl]methanol (PubChem CID 65499669) has the molecular formula C16H16BrN3O and a molecular weight of 346.23 g/mol. Its IUPAC name is [5-amino-1-(4-bromo-2,6-dimethylphenyl)benzimidazol-2-yl]methanol.
| Compound Name | [5-amino-1-(4-bromo-2,6-dimethylphenyl)benzimidazol-2-yl]methanol |
|---|---|
| PubChem CID | 65499669 |
| Molecular Formula | C16H16BrN3O |
| Molecular Weight | 346.23 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | [5-amino-1-(4-bromo-2,6-dimethylphenyl)benzimidazol-2-yl]methanol |
| SMILES | Cc1cc(Br)cc(C)c1-n1c(CO)nc2cc(N)ccc21 |
| InChI | InChI=1S/C16H16BrN3O/c1-9-5-11(17)6-10(2)16(9)20-14-4-3-12(18)7-13(14)19-15(20)8-21/h3-7,21H,8,18H2,1-2H3 |
| InChIKey | DHXYTOAUDSNYCS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.23 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|