C14H11Cl2N3O — CID 62594709
[5-amino-1-(2,5-dichlorophenyl)benzimidazol-2-yl]methanol (PubChem CID 62594709) has the molecular formula C14H11Cl2N3O and a molecular weight of 308.17 g/mol. Its IUPAC name is [5-amino-1-(2,5-dichlorophenyl)benzimidazol-2-yl]methanol.
| Compound Name | [5-amino-1-(2,5-dichlorophenyl)benzimidazol-2-yl]methanol |
|---|---|
| PubChem CID | 62594709 |
| Molecular Formula | C14H11Cl2N3O |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | [5-amino-1-(2,5-dichlorophenyl)benzimidazol-2-yl]methanol |
| SMILES | Nc1ccc2c(c1)nc(CO)n2-c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H11Cl2N3O/c15-8-1-3-10(16)13(5-8)19-12-4-2-9(17)6-11(12)18-14(19)7-20/h1-6,20H,7,17H2 |
| InChIKey | IGYPQSBKCGMVKF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|