C15H13F2N3O — CID 103587462
[5-amino-1-(2,5-difluoro-4-methylphenyl)benzimidazol-2-yl]methanol (PubChem CID 103587462) has the molecular formula C15H13F2N3O and a molecular weight of 289.29 g/mol. Its IUPAC name is [5-amino-1-(2,5-difluoro-4-methylphenyl)benzimidazol-2-yl]methanol.
| Compound Name | [5-amino-1-(2,5-difluoro-4-methylphenyl)benzimidazol-2-yl]methanol |
|---|---|
| PubChem CID | 103587462 |
| Molecular Formula | C15H13F2N3O |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | [5-amino-1-(2,5-difluoro-4-methylphenyl)benzimidazol-2-yl]methanol |
| SMILES | Cc1cc(F)c(-n2c(CO)nc3cc(N)ccc32)cc1F |
| InChI | InChI=1S/C15H13F2N3O/c1-8-4-11(17)14(6-10(8)16)20-13-3-2-9(18)5-12(13)19-15(20)7-21/h2-6,21H,7,18H2,1H3 |
| InChIKey | WLIMAAAFGYKHLO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|