C16H14BrClN2 — CID 65498853
1-(4-bromo-2,6-dimethylphenyl)-2-(chloromethyl)benzimidazole (PubChem CID 65498853) has the molecular formula C16H14BrClN2 and a molecular weight of 349.66 g/mol. Its IUPAC name is 1-(4-bromo-2,6-dimethylphenyl)-2-(chloromethyl)benzimidazole.
| Compound Name | 1-(4-bromo-2,6-dimethylphenyl)-2-(chloromethyl)benzimidazole |
|---|---|
| PubChem CID | 65498853 |
| Molecular Formula | C16H14BrClN2 |
| Molecular Weight | 349.66 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | 1-(4-bromo-2,6-dimethylphenyl)-2-(chloromethyl)benzimidazole |
| SMILES | Cc1cc(Br)cc(C)c1-n1c(CCl)nc2ccccc21 |
| InChI | InChI=1S/C16H14BrClN2/c1-10-7-12(17)8-11(2)16(10)20-14-6-4-3-5-13(14)19-15(20)9-18/h3-8H,9H2,1-2H3 |
| InChIKey | SNWMXOHVEQGDJG-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.66 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|