C20H20N4O4 — CID 146286822
methyl (2R)-2-[(3-benzyltriazol-4-yl)methoxycarbonylamino]-2-phenylacetate (PubChem CID 146286822) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is methyl (2R)-2-[(3-benzyltriazol-4-yl)methoxycarbonylamino]-2-phenylacetate.
| Compound Name | methyl (2R)-2-[(3-benzyltriazol-4-yl)methoxycarbonylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 146286822 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | methyl (2R)-2-[(3-benzyltriazol-4-yl)methoxycarbonylamino]-2-phenylacetate |
| SMILES | COC(=O)[C@H](NC(=O)OCc1cnnn1Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H20N4O4/c1-27-19(25)18(16-10-6-3-7-11-16)22-20(26)28-14-17-12-21-23-24(17)13-15-8-4-2-5-9-15/h2-12,18H,13-14H2,1H3,(H,22,26)/t18-/m1/s1 |
| InChIKey | KFLYZXJDVPDTSQ-GOSISDBHSA-N |
| XLogP | 2.47 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |