C10H16F2N2O — CID 146289749
1-[3-(2,2-difluoroethyl)-4-methylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 146289749) has the molecular formula C10H16F2N2O and a molecular weight of 218.25 g/mol. Its IUPAC name is 1-[3-(2,2-difluoroethyl)-4-methylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-(2,2-difluoroethyl)-4-methylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 146289749 |
| Molecular Formula | C10H16F2N2O |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 1-[3-(2,2-difluoroethyl)-4-methylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(C)C(CC(F)F)C1 |
| InChI | InChI=1S/C10H16F2N2O/c1-3-10(15)14-5-4-13(2)8(7-14)6-9(11)12/h3,8-9H,1,4-7H2,2H3 |
| InChIKey | FNRRKUDCJYKMJW-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|