C14H10ClFIN3S — CID 146290252
2-[4-(2-chloro-4-fluorophenyl)-5-iodo-6-methyl-1,4-dihydropyrimidin-2-yl]-1,3-thiazole (PubChem CID 146290252) has the molecular formula C14H10ClFIN3S and a molecular weight of 433.68 g/mol. Its IUPAC name is 2-[4-(2-chloro-4-fluorophenyl)-5-iodo-6-methyl-1,4-dihydropyrimidin-2-yl]-1,3-thiazole.
| Compound Name | 2-[4-(2-chloro-4-fluorophenyl)-5-iodo-6-methyl-1,4-dihydropyrimidin-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 146290252 |
| Molecular Formula | C14H10ClFIN3S |
| Molecular Weight | 433.68 g/mol |
| Exact Mass | 432.93 |
| IUPAC Name | 2-[4-(2-chloro-4-fluorophenyl)-5-iodo-6-methyl-1,4-dihydropyrimidin-2-yl]-1,3-thiazole |
| SMILES | CC1=C(I)C(c2ccc(F)cc2Cl)N=C(c2nccs2)N1 |
| InChI | InChI=1S/C14H10ClFIN3S/c1-7-11(17)12(9-3-2-8(16)6-10(9)15)20-13(19-7)14-18-4-5-21-14/h2-6,12H,1H3,(H,19,20) |
| InChIKey | FDVBBNXOMAJQBU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.68 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|