C21H22BClFN4O4S2 — CID 157139862
CID 157139862 (PubChem CID 157139862) has the molecular formula C21H22BClFN4O4S2 and a molecular weight of 523.83 g/mol.
| Compound Name | CID 157139862 |
|---|---|
| PubChem CID | 157139862 |
| Molecular Formula | C21H22BClFN4O4S2 |
| Molecular Weight | 523.83 g/mol |
| Exact Mass | 523.08 |
| IUPAC Name | — |
| SMILES | CC1=C(C(=O)O[C@@H](C)C(=O)OC(C)C)[C@H](c2ccc(F)cc2Cl)N=C(c2nccs2)N1.[B]=NS |
| InChI | InChI=1S/C21H21ClFN3O4S.BHNS/c1-10(2)29-20(27)12(4)30-21(28)16-11(3)25-18(19-24-7-8-31-19)26-17(16)14-6-5-13(23)9-15(14)22;1-2-3/h5-10,12,17H,1-4H3,(H,25,26);3H/t12-,17-;/m0./s1 |
| InChIKey | DAWBFSUOHOBEQM-XHXSRVRCSA-N |
| XLogP | 4.37 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.83 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|