C17H15N3O3 — CID 146290943
5-amino-4-(3-phenylmethoxyphenoxy)-1H-pyrimidin-6-one (PubChem CID 146290943) has the molecular formula C17H15N3O3 and a molecular weight of 309.33 g/mol. Its IUPAC name is 5-amino-4-(3-phenylmethoxyphenoxy)-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-(3-phenylmethoxyphenoxy)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 146290943 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 5-amino-4-(3-phenylmethoxyphenoxy)-1H-pyrimidin-6-one |
| SMILES | Nc1c(Oc2cccc(OCc3ccccc3)c2)nc[nH]c1=O |
| InChI | InChI=1S/C17H15N3O3/c18-15-16(21)19-11-20-17(15)23-14-8-4-7-13(9-14)22-10-12-5-2-1-3-6-12/h1-9,11H,10,18H2,(H,19,20,21) |
| InChIKey | YASXEZBFEAQIEY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |