C15H12Cl5NO5 — CID 146291081
azane;2,3-dichlorobenzoic acid;3,4,5-trichloro-2-methoxybenzoic acid (PubChem CID 146291081) has the molecular formula C15H12Cl5NO5 and a molecular weight of 463.53 g/mol. Its IUPAC name is azane;2,3-dichlorobenzoic acid;3,4,5-trichloro-2-methoxybenzoic acid.
| Compound Name | azane;2,3-dichlorobenzoic acid;3,4,5-trichloro-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 146291081 |
| Molecular Formula | C15H12Cl5NO5 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 460.92 |
| IUPAC Name | azane;2,3-dichlorobenzoic acid;3,4,5-trichloro-2-methoxybenzoic acid |
| SMILES | COc1c(C(=O)O)cc(Cl)c(Cl)c1Cl.N.O=C(O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C8H5Cl3O3.C7H4Cl2O2.H3N/c1-14-7-3(8(12)13)2-4(9)5(10)6(7)11;8-5-3-1-2-4(6(5)9)7(10)11;/h2H,1H3,(H,12,13);1-3H,(H,10,11);1H3 |
| InChIKey | FZOUNNZWKZMJRQ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 118.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|