C15H11ClF3N — CID 146292569
2-[(E)-1-chloroprop-1-enyl]-3-methyl-5-(2,3,4-trifluorophenyl)pyridine (PubChem CID 146292569) has the molecular formula C15H11ClF3N and a molecular weight of 297.71 g/mol. Its IUPAC name is 2-[(E)-1-chloroprop-1-enyl]-3-methyl-5-(2,3,4-trifluorophenyl)pyridine.
| Compound Name | 2-[(E)-1-chloroprop-1-enyl]-3-methyl-5-(2,3,4-trifluorophenyl)pyridine |
|---|---|
| PubChem CID | 146292569 |
| Molecular Formula | C15H11ClF3N |
| Molecular Weight | 297.71 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 2-[(E)-1-chloroprop-1-enyl]-3-methyl-5-(2,3,4-trifluorophenyl)pyridine |
| SMILES | C/C=C(/Cl)c1ncc(-c2ccc(F)c(F)c2F)cc1C |
| InChI | InChI=1S/C15H11ClF3N/c1-3-11(16)15-8(2)6-9(7-20-15)10-4-5-12(17)14(19)13(10)18/h3-7H,1-2H3/b11-3+ |
| InChIKey | PCUMWEAWKGTLCC-QDEBKDIKSA-N |
| XLogP | 5.07 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.71 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|