C20H18N6O — CID 146293961
3-[4-(3-methylimidazol-4-yl)triazol-1-yl]-N-(3-methylphenyl)benzamide (PubChem CID 146293961) has the molecular formula C20H18N6O and a molecular weight of 358.41 g/mol. Its IUPAC name is 3-[4-(3-methylimidazol-4-yl)triazol-1-yl]-N-(3-methylphenyl)benzamide.
| Compound Name | 3-[4-(3-methylimidazol-4-yl)triazol-1-yl]-N-(3-methylphenyl)benzamide |
|---|---|
| PubChem CID | 146293961 |
| Molecular Formula | C20H18N6O |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 3-[4-(3-methylimidazol-4-yl)triazol-1-yl]-N-(3-methylphenyl)benzamide |
| SMILES | Cc1cccc(NC(=O)c2cccc(-n3cc(-c4cncn4C)nn3)c2)c1 |
| InChI | InChI=1S/C20H18N6O/c1-14-5-3-7-16(9-14)22-20(27)15-6-4-8-17(10-15)26-12-18(23-24-26)19-11-21-13-25(19)2/h3-13H,1-2H3,(H,22,27) |
| InChIKey | GMHLDODISHFXDZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |