C21H16F4N6O2 — CID 146294026
3-[4-(3-methylimidazol-4-yl)triazol-1-yl]-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]benzamide (PubChem CID 146294026) has the molecular formula C21H16F4N6O2 and a molecular weight of 460.39 g/mol. Its IUPAC name is 3-[4-(3-methylimidazol-4-yl)triazol-1-yl]-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]benzamide.
| Compound Name | 3-[4-(3-methylimidazol-4-yl)triazol-1-yl]-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 146294026 |
| Molecular Formula | C21H16F4N6O2 |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 3-[4-(3-methylimidazol-4-yl)triazol-1-yl]-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]benzamide |
| SMILES | Cn1cncc1-c1cn(-c2cccc(C(=O)Nc3cccc(OC(F)(F)C(F)F)c3)c2)nn1 |
| InChI | InChI=1S/C21H16F4N6O2/c1-30-12-26-10-18(30)17-11-31(29-28-17)15-6-2-4-13(8-15)19(32)27-14-5-3-7-16(9-14)33-21(24,25)20(22)23/h2-12,20H,1H3,(H,27,32) |
| InChIKey | MRSDSXYZJMGKTQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|