C27H30N6O2 — CID 66558827
N-[4-[3-[4-(diethylaminomethyl)triazol-1-yl]anilino]phenyl]-3-methoxybenzamide (PubChem CID 66558827) has the molecular formula C27H30N6O2 and a molecular weight of 470.58 g/mol. Its IUPAC name is N-[4-[3-[4-(diethylaminomethyl)triazol-1-yl]anilino]phenyl]-3-methoxybenzamide.
| Compound Name | N-[4-[3-[4-(diethylaminomethyl)triazol-1-yl]anilino]phenyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 66558827 |
| Molecular Formula | C27H30N6O2 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | N-[4-[3-[4-(diethylaminomethyl)triazol-1-yl]anilino]phenyl]-3-methoxybenzamide |
| SMILES | CCN(CC)Cc1cn(-c2cccc(Nc3ccc(NC(=O)c4cccc(OC)c4)cc3)c2)nn1 |
| InChI | InChI=1S/C27H30N6O2/c1-4-32(5-2)18-24-19-33(31-30-24)25-10-7-9-23(17-25)28-21-12-14-22(15-13-21)29-27(34)20-8-6-11-26(16-20)35-3/h6-17,19,28H,4-5,18H2,1-3H3,(H,29,34) |
| InChIKey | CJOQBDSWXBODEU-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |