C39H36F2N6O7 — CID 146293997
N-[4-(2,4-difluorophenoxy)-3-(6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridin-4-yl)phenyl]-6-[[2-(6-hydroxy-2-oxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]hexanamide (PubChem CID 146293997) has the molecular formula C39H36F2N6O7 and a molecular weight of 738.75 g/mol. Its IUPAC name is N-[4-(2,4-difluorophenoxy)-3-(6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridin-4-yl)phenyl]-6-[[2-(6-hydroxy-2-oxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]hexanamide.
| Compound Name | N-[4-(2,4-difluorophenoxy)-3-(6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridin-4-yl)phenyl]-6-[[2-(6-hydroxy-2-oxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]hexanamide |
|---|---|
| PubChem CID | 146293997 |
| Molecular Formula | C39H36F2N6O7 |
| Molecular Weight | 738.75 g/mol |
| Exact Mass | 738.26 |
| IUPAC Name | N-[4-(2,4-difluorophenoxy)-3-(6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridin-4-yl)phenyl]-6-[[2-(6-hydroxy-2-oxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]hexanamide |
| SMILES | Cn1cc(-c2cc(NC(=O)CCCCCNc3ccc4c(c3)C(=O)N(C3CCC(O)NC3=O)C4=O)ccc2Oc2ccc(F)cc2F)c2cc[nH]c2c1=O |
| InChI | InChI=1S/C39H36F2N6O7/c1-46-20-28(24-14-16-43-35(24)39(46)53)26-19-23(8-12-31(26)54-32-11-6-21(40)17-29(32)41)44-33(48)5-3-2-4-15-42-22-7-9-25-27(18-22)38(52)47(37(25)51)30-10-13-34(49)45-36(30)50/h6-9,11-12,14,16-20,30,34,42-43,49H,2-5,10,13,15H2,1H3,(H,44,48)(H,45,50) |
| InChIKey | JQABWDGGBCCFLO-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 174.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.75 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|