C39H38F2N6O6 — CID 167507910
N'-[4-(2,4-difluorophenoxy)-3-(6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridin-4-yl)phenyl]-N-[4-[(2-methyl-1,3-dioxoisoindol-4-yl)amino]butyl]hexanediamide (PubChem CID 167507910) has the molecular formula C39H38F2N6O6 and a molecular weight of 724.77 g/mol. Its IUPAC name is N'-[4-(2,4-difluorophenoxy)-3-(6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridin-4-yl)phenyl]-N-[4-[(2-methyl-1,3-dioxoisoindol-4-yl)amino]butyl]hexanediamide.
| Compound Name | N'-[4-(2,4-difluorophenoxy)-3-(6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridin-4-yl)phenyl]-N-[4-[(2-methyl-1,3-dioxoisoindol-4-yl)amino]butyl]hexanediamide |
|---|---|
| PubChem CID | 167507910 |
| Molecular Formula | C39H38F2N6O6 |
| Molecular Weight | 724.77 g/mol |
| Exact Mass | 724.28 |
| IUPAC Name | N'-[4-(2,4-difluorophenoxy)-3-(6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridin-4-yl)phenyl]-N-[4-[(2-methyl-1,3-dioxoisoindol-4-yl)amino]butyl]hexanediamide |
| SMILES | CN1C(=O)c2cccc(NCCCCNC(=O)CCCCC(=O)Nc3ccc(Oc4ccc(F)cc4F)c(-c4cn(C)c(=O)c5[nH]ccc45)c3)c2C1=O |
| InChI | InChI=1S/C39H38F2N6O6/c1-46-22-28(25-16-19-44-36(25)39(46)52)27-21-24(13-15-31(27)53-32-14-12-23(40)20-29(32)41)45-34(49)11-4-3-10-33(48)43-18-6-5-17-42-30-9-7-8-26-35(30)38(51)47(2)37(26)50/h7-9,12-16,19-22,42,44H,3-6,10-11,17-18H2,1-2H3,(H,43,48)(H,45,49) |
| InChIKey | INTNMDBNPCZZNH-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 154.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.77 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|