C25H27N3O — CID 146295769
N-(2,2-dimethylpropyl)-3-[4-(2-pyridin-2-ylethenyl)anilino]benzamide (PubChem CID 146295769) has the molecular formula C25H27N3O and a molecular weight of 385.51 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-3-[4-(2-pyridin-2-ylethenyl)anilino]benzamide.
| Compound Name | N-(2,2-dimethylpropyl)-3-[4-(2-pyridin-2-ylethenyl)anilino]benzamide |
|---|---|
| PubChem CID | 146295769 |
| Molecular Formula | C25H27N3O |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | N-(2,2-dimethylpropyl)-3-[4-(2-pyridin-2-ylethenyl)anilino]benzamide |
| SMILES | CC(C)(C)CNC(=O)c1cccc(Nc2ccc(C=Cc3ccccn3)cc2)c1 |
| InChI | InChI=1S/C25H27N3O/c1-25(2,3)18-27-24(29)20-7-6-9-23(17-20)28-22-14-11-19(12-15-22)10-13-21-8-4-5-16-26-21/h4-17,28H,18H2,1-3H3,(H,27,29) |
| InChIKey | MVSQVLWLEJUIAS-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |