C27H28N6O — CID 146295896
2-cyclopropyl-N-[3-[2-(3-methylbut-2-enyl)tetrazol-5-yl]phenyl]-4-(pyridin-2-ylmethoxy)aniline (PubChem CID 146295896) has the molecular formula C27H28N6O and a molecular weight of 452.56 g/mol. Its IUPAC name is 2-cyclopropyl-N-[3-[2-(3-methylbut-2-enyl)tetrazol-5-yl]phenyl]-4-(pyridin-2-ylmethoxy)aniline.
| Compound Name | 2-cyclopropyl-N-[3-[2-(3-methylbut-2-enyl)tetrazol-5-yl]phenyl]-4-(pyridin-2-ylmethoxy)aniline |
|---|---|
| PubChem CID | 146295896 |
| Molecular Formula | C27H28N6O |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 2-cyclopropyl-N-[3-[2-(3-methylbut-2-enyl)tetrazol-5-yl]phenyl]-4-(pyridin-2-ylmethoxy)aniline |
| SMILES | CC(C)=CCn1nnc(-c2cccc(Nc3ccc(OCc4ccccn4)cc3C3CC3)c2)n1 |
| InChI | InChI=1S/C27H28N6O/c1-19(2)13-15-33-31-27(30-32-33)21-6-5-8-22(16-21)29-26-12-11-24(17-25(26)20-9-10-20)34-18-23-7-3-4-14-28-23/h3-8,11-14,16-17,20,29H,9-10,15,18H2,1-2H3 |
| InChIKey | ASKARMPXDYQDNU-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|