C27H31N3O2 — CID 146295816
2-[2-cyclopropyl-4-(pyridin-2-ylmethoxy)anilino]-N-(3-methylbutyl)benzamide (PubChem CID 146295816) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is 2-[2-cyclopropyl-4-(pyridin-2-ylmethoxy)anilino]-N-(3-methylbutyl)benzamide.
| Compound Name | 2-[2-cyclopropyl-4-(pyridin-2-ylmethoxy)anilino]-N-(3-methylbutyl)benzamide |
|---|---|
| PubChem CID | 146295816 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 2-[2-cyclopropyl-4-(pyridin-2-ylmethoxy)anilino]-N-(3-methylbutyl)benzamide |
| SMILES | CC(C)CCNC(=O)c1ccccc1Nc1ccc(OCc2ccccn2)cc1C1CC1 |
| InChI | InChI=1S/C27H31N3O2/c1-19(2)14-16-29-27(31)23-8-3-4-9-25(23)30-26-13-12-22(17-24(26)20-10-11-20)32-18-21-7-5-6-15-28-21/h3-9,12-13,15,17,19-20,30H,10-11,14,16,18H2,1-2H3,(H,29,31) |
| InChIKey | HNKTWTBUFUDJIB-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |