C25H26N2O3 — CID 86970699
2-cyclobutyloxy-N-[1-[3-(pyridin-2-ylmethoxy)phenyl]ethyl]benzamide (PubChem CID 86970699) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is 2-cyclobutyloxy-N-[1-[3-(pyridin-2-ylmethoxy)phenyl]ethyl]benzamide.
| Compound Name | 2-cyclobutyloxy-N-[1-[3-(pyridin-2-ylmethoxy)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 86970699 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 2-cyclobutyloxy-N-[1-[3-(pyridin-2-ylmethoxy)phenyl]ethyl]benzamide |
| SMILES | CC(NC(=O)c1ccccc1OC1CCC1)c1cccc(OCc2ccccn2)c1 |
| InChI | InChI=1S/C25H26N2O3/c1-18(19-8-6-12-22(16-19)29-17-20-9-4-5-15-26-20)27-25(28)23-13-2-3-14-24(23)30-21-10-7-11-21/h2-6,8-9,12-16,18,21H,7,10-11,17H2,1H3,(H,27,28) |
| InChIKey | LPBDWMHQRQHUIE-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |