C32H39NO4 — CID 146295940
3-[3-(3-cyclohexylpropoxy)-N-(2-methyl-4-phenylmethoxyphenyl)anilino]propanoic acid (PubChem CID 146295940) has the molecular formula C32H39NO4 and a molecular weight of 501.67 g/mol. Its IUPAC name is 3-[3-(3-cyclohexylpropoxy)-N-(2-methyl-4-phenylmethoxyphenyl)anilino]propanoic acid.
| Compound Name | 3-[3-(3-cyclohexylpropoxy)-N-(2-methyl-4-phenylmethoxyphenyl)anilino]propanoic acid |
|---|---|
| PubChem CID | 146295940 |
| Molecular Formula | C32H39NO4 |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | 3-[3-(3-cyclohexylpropoxy)-N-(2-methyl-4-phenylmethoxyphenyl)anilino]propanoic acid |
| SMILES | Cc1cc(OCc2ccccc2)ccc1N(CCC(=O)O)c1cccc(OCCCC2CCCCC2)c1 |
| InChI | InChI=1S/C32H39NO4/c1-25-22-30(37-24-27-12-6-3-7-13-27)17-18-31(25)33(20-19-32(34)35)28-15-8-16-29(23-28)36-21-9-14-26-10-4-2-5-11-26/h3,6-8,12-13,15-18,22-23,26H,2,4-5,9-11,14,19-21,24H2,1H3,(H,34,35) |
| InChIKey | CKFNAUKTVDKBTP-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|