C30H33NO5 — CID 66912825
(2S)-3-cyclohexyl-2-[[3-[(4-phenylmethoxyphenyl)methoxy]benzoyl]amino]propanoic acid (PubChem CID 66912825) has the molecular formula C30H33NO5 and a molecular weight of 487.60 g/mol. Its IUPAC name is (2S)-3-cyclohexyl-2-[[3-[(4-phenylmethoxyphenyl)methoxy]benzoyl]amino]propanoic acid.
| Compound Name | (2S)-3-cyclohexyl-2-[[3-[(4-phenylmethoxyphenyl)methoxy]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 66912825 |
| Molecular Formula | C30H33NO5 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | (2S)-3-cyclohexyl-2-[[3-[(4-phenylmethoxyphenyl)methoxy]benzoyl]amino]propanoic acid |
| SMILES | O=C(N[C@@H](CC1CCCCC1)C(=O)O)c1cccc(OCc2ccc(OCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C30H33NO5/c32-29(31-28(30(33)34)18-22-8-3-1-4-9-22)25-12-7-13-27(19-25)36-21-24-14-16-26(17-15-24)35-20-23-10-5-2-6-11-23/h2,5-7,10-17,19,22,28H,1,3-4,8-9,18,20-21H2,(H,31,32)(H,33,34)/t28-/m0/s1 |
| InChIKey | KETNCNOBIWWLQH-NDEPHWFRSA-N |
| XLogP | 6.00 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |