C27H31N3O5 — CID 66912894
(2S)-3-cyclohexyl-2-[[3-[2-(3-methylquinoxalin-2-yl)oxyethoxy]benzoyl]amino]propanoic acid (PubChem CID 66912894) has the molecular formula C27H31N3O5 and a molecular weight of 477.56 g/mol. Its IUPAC name is (2S)-3-cyclohexyl-2-[[3-[2-(3-methylquinoxalin-2-yl)oxyethoxy]benzoyl]amino]propanoic acid.
| Compound Name | (2S)-3-cyclohexyl-2-[[3-[2-(3-methylquinoxalin-2-yl)oxyethoxy]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 66912894 |
| Molecular Formula | C27H31N3O5 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | (2S)-3-cyclohexyl-2-[[3-[2-(3-methylquinoxalin-2-yl)oxyethoxy]benzoyl]amino]propanoic acid |
| SMILES | Cc1nc2ccccc2nc1OCCOc1cccc(C(=O)N[C@@H](CC2CCCCC2)C(=O)O)c1 |
| InChI | InChI=1S/C27H31N3O5/c1-18-26(30-23-13-6-5-12-22(23)28-18)35-15-14-34-21-11-7-10-20(17-21)25(31)29-24(27(32)33)16-19-8-3-2-4-9-19/h5-7,10-13,17,19,24H,2-4,8-9,14-16H2,1H3,(H,29,31)(H,32,33)/t24-/m0/s1 |
| InChIKey | RHNPOGZSXYNICV-DEOSSOPVSA-N |
| XLogP | 4.55 |
| TPSA | 110.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|