C26H35N3O6 — CID 146296765
3-[6-[2-[(4-methoxyoxan-4-yl)methylamino]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 146296765) has the molecular formula C26H35N3O6 and a molecular weight of 485.58 g/mol. Its IUPAC name is 3-[6-[2-[(4-methoxyoxan-4-yl)methylamino]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[2-[(4-methoxyoxan-4-yl)methylamino]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146296765 |
| Molecular Formula | C26H35N3O6 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | 3-[6-[2-[(4-methoxyoxan-4-yl)methylamino]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | COC1(CNC2CCCCC2Oc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)CCOCC1 |
| InChI | InChI=1S/C26H35N3O6/c1-33-26(10-12-34-13-11-26)16-27-20-4-2-3-5-22(20)35-18-6-7-19-17(14-18)15-29(25(19)32)21-8-9-23(30)28-24(21)31/h6-7,14,20-22,27H,2-5,8-13,15-16H2,1H3,(H,28,30,31) |
| InChIKey | JTBRAUUOQJXMMT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|