C24H28F3N3O4 — CID 146300305
3-[3-oxo-6-[(1S,2S)-2-[[1-(trifluoromethyl)cyclopropyl]methylamino]cyclohexyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 146300305) has the molecular formula C24H28F3N3O4 and a molecular weight of 479.50 g/mol. Its IUPAC name is 3-[3-oxo-6-[(1S,2S)-2-[[1-(trifluoromethyl)cyclopropyl]methylamino]cyclohexyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[(1S,2S)-2-[[1-(trifluoromethyl)cyclopropyl]methylamino]cyclohexyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146300305 |
| Molecular Formula | C24H28F3N3O4 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 3-[3-oxo-6-[(1S,2S)-2-[[1-(trifluoromethyl)cyclopropyl]methylamino]cyclohexyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(O[C@H]4CCCC[C@@H]4NCC4(C(F)(F)F)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H28F3N3O4/c25-24(26,27)23(9-10-23)13-28-17-3-1-2-4-19(17)34-15-5-6-16-14(11-15)12-30(22(16)33)18-7-8-20(31)29-21(18)32/h5-6,11,17-19,28H,1-4,7-10,12-13H2,(H,29,31,32)/t17-,18?,19-/m0/s1 |
| InChIKey | QTFPMHDBAAUKKC-JVUMBYKBSA-N |
| XLogP | 3.07 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|