C23H25FN4O2 — CID 146296948
N-(3-fluoro-1-methylindol-5-yl)-2-[4-[(4-methylphenyl)methyl]piperazin-1-yl]-2-oxoacetamide (PubChem CID 146296948) has the molecular formula C23H25FN4O2 and a molecular weight of 408.48 g/mol. Its IUPAC name is N-(3-fluoro-1-methylindol-5-yl)-2-[4-[(4-methylphenyl)methyl]piperazin-1-yl]-2-oxoacetamide.
| Compound Name | N-(3-fluoro-1-methylindol-5-yl)-2-[4-[(4-methylphenyl)methyl]piperazin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 146296948 |
| Molecular Formula | C23H25FN4O2 |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N-(3-fluoro-1-methylindol-5-yl)-2-[4-[(4-methylphenyl)methyl]piperazin-1-yl]-2-oxoacetamide |
| SMILES | Cc1ccc(CN2CCN(C(=O)C(=O)Nc3ccc4c(c3)c(F)cn4C)CC2)cc1 |
| InChI | InChI=1S/C23H25FN4O2/c1-16-3-5-17(6-4-16)14-27-9-11-28(12-10-27)23(30)22(29)25-18-7-8-21-19(13-18)20(24)15-26(21)2/h3-8,13,15H,9-12,14H2,1-2H3,(H,25,29) |
| InChIKey | YBNNEUVNSBOAPO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|