C15H12ClF2N5O — CID 146301974
3-chloro-6-[[3-[4-(difluoromethyl)phenyl]-5-methyltriazol-4-yl]methoxy]pyridazine (PubChem CID 146301974) has the molecular formula C15H12ClF2N5O and a molecular weight of 351.74 g/mol. Its IUPAC name is 3-chloro-6-[[3-[4-(difluoromethyl)phenyl]-5-methyltriazol-4-yl]methoxy]pyridazine.
| Compound Name | 3-chloro-6-[[3-[4-(difluoromethyl)phenyl]-5-methyltriazol-4-yl]methoxy]pyridazine |
|---|---|
| PubChem CID | 146301974 |
| Molecular Formula | C15H12ClF2N5O |
| Molecular Weight | 351.74 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 3-chloro-6-[[3-[4-(difluoromethyl)phenyl]-5-methyltriazol-4-yl]methoxy]pyridazine |
| SMILES | Cc1nnn(-c2ccc(C(F)F)cc2)c1COc1ccc(Cl)nn1 |
| InChI | InChI=1S/C15H12ClF2N5O/c1-9-12(8-24-14-7-6-13(16)20-21-14)23(22-19-9)11-4-2-10(3-5-11)15(17)18/h2-7,15H,8H2,1H3 |
| InChIKey | LZUUUJYQEWUNAK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.74 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |