C23H23F2N5O — CID 162723318
3-[[3-[4-(difluoromethyl)phenyl]-5-methyltriazol-4-yl]methoxy]-6-[(2E,4Z)-octa-2,4,7-trien-2-yl]pyridazine (PubChem CID 162723318) has the molecular formula C23H23F2N5O and a molecular weight of 423.47 g/mol. Its IUPAC name is 3-[[3-[4-(difluoromethyl)phenyl]-5-methyltriazol-4-yl]methoxy]-6-[(2E,4Z)-octa-2,4,7-trien-2-yl]pyridazine.
| Compound Name | 3-[[3-[4-(difluoromethyl)phenyl]-5-methyltriazol-4-yl]methoxy]-6-[(2E,4Z)-octa-2,4,7-trien-2-yl]pyridazine |
|---|---|
| PubChem CID | 162723318 |
| Molecular Formula | C23H23F2N5O |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 3-[[3-[4-(difluoromethyl)phenyl]-5-methyltriazol-4-yl]methoxy]-6-[(2E,4Z)-octa-2,4,7-trien-2-yl]pyridazine |
| SMILES | C=CC/C=C\C=C(/C)c1ccc(OCc2c(C)nnn2-c2ccc(C(F)F)cc2)nn1 |
| InChI | InChI=1S/C23H23F2N5O/c1-4-5-6-7-8-16(2)20-13-14-22(28-27-20)31-15-21-17(3)26-29-30(21)19-11-9-18(10-12-19)23(24)25/h4,6-14,23H,1,5,15H2,2-3H3/b7-6-,16-8+ |
| InChIKey | ZOPMVRHHENDHBA-VZNCOVNJSA-N |
| XLogP | 5.42 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|