C15H7F6N3O2 — CID 146309662
4-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]-1-[(2,4,5-trifluorophenyl)methyl]pyridin-2-one (PubChem CID 146309662) has the molecular formula C15H7F6N3O2 and a molecular weight of 375.23 g/mol. Its IUPAC name is 4-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]-1-[(2,4,5-trifluorophenyl)methyl]pyridin-2-one.
| Compound Name | 4-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]-1-[(2,4,5-trifluorophenyl)methyl]pyridin-2-one |
|---|---|
| PubChem CID | 146309662 |
| Molecular Formula | C15H7F6N3O2 |
| Molecular Weight | 375.23 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | 4-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]-1-[(2,4,5-trifluorophenyl)methyl]pyridin-2-one |
| SMILES | O=c1cc(-c2nnc(C(F)(F)F)o2)ccn1Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C15H7F6N3O2/c16-9-5-11(18)10(17)3-8(9)6-24-2-1-7(4-12(24)25)13-22-23-14(26-13)15(19,20)21/h1-5H,6H2 |
| InChIKey | ZTOFFBKGKCVGQX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.23 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|