C13H12F3N3O2 — CID 146309746
1-(3-methylbut-2-enyl)-4-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]pyridin-2-one (PubChem CID 146309746) has the molecular formula C13H12F3N3O2 and a molecular weight of 299.25 g/mol. Its IUPAC name is 1-(3-methylbut-2-enyl)-4-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]pyridin-2-one.
| Compound Name | 1-(3-methylbut-2-enyl)-4-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]pyridin-2-one |
|---|---|
| PubChem CID | 146309746 |
| Molecular Formula | C13H12F3N3O2 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 1-(3-methylbut-2-enyl)-4-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]pyridin-2-one |
| SMILES | CC(C)=CCn1ccc(-c2nnc(C(F)(F)F)o2)cc1=O |
| InChI | InChI=1S/C13H12F3N3O2/c1-8(2)3-5-19-6-4-9(7-10(19)20)11-17-18-12(21-11)13(14,15)16/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | BPUUKKCVMAMQGJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|