C27H32ClN3O2 — CID 146310630
3-[6-[benzyl(2-methylpropyl)amino]-4-(4-chloroanilino)-2-pyridinyl]pentanoic acid (PubChem CID 146310630) has the molecular formula C27H32ClN3O2 and a molecular weight of 466.03 g/mol. Its IUPAC name is 3-[6-[benzyl(2-methylpropyl)amino]-4-(4-chloroanilino)-2-pyridinyl]pentanoic acid.
| Compound Name | 3-[6-[benzyl(2-methylpropyl)amino]-4-(4-chloroanilino)-2-pyridinyl]pentanoic acid |
|---|---|
| PubChem CID | 146310630 |
| Molecular Formula | C27H32ClN3O2 |
| Molecular Weight | 466.03 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 3-[6-[benzyl(2-methylpropyl)amino]-4-(4-chloroanilino)-2-pyridinyl]pentanoic acid |
| SMILES | CCC(CC(=O)O)c1cc(Nc2ccc(Cl)cc2)cc(N(Cc2ccccc2)CC(C)C)n1 |
| InChI | InChI=1S/C27H32ClN3O2/c1-4-21(14-27(32)33)25-15-24(29-23-12-10-22(28)11-13-23)16-26(30-25)31(17-19(2)3)18-20-8-6-5-7-9-20/h5-13,15-16,19,21H,4,14,17-18H2,1-3H3,(H,29,30)(H,32,33) |
| InChIKey | LRZJEYVLJHGYSL-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.03 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |