C17H23NO3 — CID 14631307
[(1S,4S)-4-[(1E,3E)-4-cyano-3-methylbuta-1,3-dienyl]-4-hydroxy-3,5,5-trimethylcyclohex-2-en-1-yl] acetate (PubChem CID 14631307) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is [(1S,4S)-4-[(1E,3E)-4-cyano-3-methylbuta-1,3-dienyl]-4-hydroxy-3,5,5-trimethylcyclohex-2-en-1-yl] acetate.
| Compound Name | [(1S,4S)-4-[(1E,3E)-4-cyano-3-methylbuta-1,3-dienyl]-4-hydroxy-3,5,5-trimethylcyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 14631307 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | [(1S,4S)-4-[(1E,3E)-4-cyano-3-methylbuta-1,3-dienyl]-4-hydroxy-3,5,5-trimethylcyclohex-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=C(C)[C@](O)(/C=C/C(C)=C/C#N)C(C)(C)C1 |
| InChI | InChI=1S/C17H23NO3/c1-12(7-9-18)6-8-17(20)13(2)10-15(21-14(3)19)11-16(17,4)5/h6-8,10,15,20H,11H2,1-5H3/b8-6+,12-7+/t15-,17-/m1/s1 |
| InChIKey | NEQGIHPMWXJTDK-YMIUJFGFSA-N |
| XLogP | 3.05 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|