C29H37FN4O4 — CID 146313859
3-[(dipentylamino)methyl]-4-[[6-fluoro-8-(methylamino)-2-oxo-1H-quinoline-3-carbonyl]amino]benzoic acid (PubChem CID 146313859) has the molecular formula C29H37FN4O4 and a molecular weight of 524.64 g/mol. Its IUPAC name is 3-[(dipentylamino)methyl]-4-[[6-fluoro-8-(methylamino)-2-oxo-1H-quinoline-3-carbonyl]amino]benzoic acid.
| Compound Name | 3-[(dipentylamino)methyl]-4-[[6-fluoro-8-(methylamino)-2-oxo-1H-quinoline-3-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 146313859 |
| Molecular Formula | C29H37FN4O4 |
| Molecular Weight | 524.64 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | 3-[(dipentylamino)methyl]-4-[[6-fluoro-8-(methylamino)-2-oxo-1H-quinoline-3-carbonyl]amino]benzoic acid |
| SMILES | CCCCCN(CCCCC)Cc1cc(C(=O)O)ccc1NC(=O)c1cc2cc(F)cc(NC)c2[nH]c1=O |
| InChI | InChI=1S/C29H37FN4O4/c1-4-6-8-12-34(13-9-7-5-2)18-21-14-19(29(37)38)10-11-24(21)32-27(35)23-16-20-15-22(30)17-25(31-3)26(20)33-28(23)36/h10-11,14-17,31H,4-9,12-13,18H2,1-3H3,(H,32,35)(H,33,36)(H,37,38) |
| InChIKey | DFZMJDOPWZIKHC-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.64 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|