C28H37N5O4 — CID 146313865
3-[(dipentylamino)methyl]-4-[[8-(methylamino)-2-oxo-1H-1,6-naphthyridine-3-carbonyl]amino]benzoic acid (PubChem CID 146313865) has the molecular formula C28H37N5O4 and a molecular weight of 507.64 g/mol. Its IUPAC name is 3-[(dipentylamino)methyl]-4-[[8-(methylamino)-2-oxo-1H-1,6-naphthyridine-3-carbonyl]amino]benzoic acid.
| Compound Name | 3-[(dipentylamino)methyl]-4-[[8-(methylamino)-2-oxo-1H-1,6-naphthyridine-3-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 146313865 |
| Molecular Formula | C28H37N5O4 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | 3-[(dipentylamino)methyl]-4-[[8-(methylamino)-2-oxo-1H-1,6-naphthyridine-3-carbonyl]amino]benzoic acid |
| SMILES | CCCCCN(CCCCC)Cc1cc(C(=O)O)ccc1NC(=O)c1cc2cncc(NC)c2[nH]c1=O |
| InChI | InChI=1S/C28H37N5O4/c1-4-6-8-12-33(13-9-7-5-2)18-21-14-19(28(36)37)10-11-23(21)31-26(34)22-15-20-16-30-17-24(29-3)25(20)32-27(22)35/h10-11,14-17,29H,4-9,12-13,18H2,1-3H3,(H,31,34)(H,32,35)(H,36,37) |
| InChIKey | VTCNIYBCXWXVHW-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 127.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|