C32H39F5N2O4 — CID 146314553
(3S)-3-cyclopropyl-3-[3-[[1-[5-methoxy-2-[1-(2,2,3,3,3-pentafluoropropyl)pyrrolidin-2-yl]phenyl]piperidin-4-yl]methoxy]phenyl]propanoic acid (PubChem CID 146314553) has the molecular formula C32H39F5N2O4 and a molecular weight of 610.66 g/mol. Its IUPAC name is (3S)-3-cyclopropyl-3-[3-[[1-[5-methoxy-2-[1-(2,2,3,3,3-pentafluoropropyl)pyrrolidin-2-yl]phenyl]piperidin-4-yl]methoxy]phenyl]propanoic acid.
| Compound Name | (3S)-3-cyclopropyl-3-[3-[[1-[5-methoxy-2-[1-(2,2,3,3,3-pentafluoropropyl)pyrrolidin-2-yl]phenyl]piperidin-4-yl]methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 146314553 |
| Molecular Formula | C32H39F5N2O4 |
| Molecular Weight | 610.66 g/mol |
| Exact Mass | 610.28 |
| IUPAC Name | (3S)-3-cyclopropyl-3-[3-[[1-[5-methoxy-2-[1-(2,2,3,3,3-pentafluoropropyl)pyrrolidin-2-yl]phenyl]piperidin-4-yl]methoxy]phenyl]propanoic acid |
| SMILES | COc1ccc(C2CCCN2CC(F)(F)C(F)(F)F)c(N2CCC(COc3cccc([C@@H](CC(=O)O)C4CC4)c3)CC2)c1 |
| InChI | InChI=1S/C32H39F5N2O4/c1-42-24-9-10-26(28-6-3-13-39(28)20-31(33,34)32(35,36)37)29(17-24)38-14-11-21(12-15-38)19-43-25-5-2-4-23(16-25)27(18-30(40)41)22-7-8-22/h2,4-5,9-10,16-17,21-22,27-28H,3,6-8,11-15,18-20H2,1H3,(H,40,41)/t27-,28?/m0/s1 |
| InChIKey | AWNAQIYDALRXJG-MBMZGMDYSA-N |
| XLogP | 7.29 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.66 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|