C30H36F8N2O4S — CID 161387227
(3S)-3-cyclopropyl-3-[3-[[1-[5-methoxy-2-[2,2,2-trifluoro-1-(2,2,3,3,3-pentafluoropropylamino)ethyl]phenyl]piperidin-4-yl]methoxy]phenyl]propanoic acid;sulfane (PubChem CID 161387227) has the molecular formula C30H36F8N2O4S and a molecular weight of 672.68 g/mol. Its IUPAC name is (3S)-3-cyclopropyl-3-[3-[[1-[5-methoxy-2-[2,2,2-trifluoro-1-(2,2,3,3,3-pentafluoropropylamino)ethyl]phenyl]piperidin-4-yl]methoxy]phenyl]propanoic acid;sulfane.
| Compound Name | (3S)-3-cyclopropyl-3-[3-[[1-[5-methoxy-2-[2,2,2-trifluoro-1-(2,2,3,3,3-pentafluoropropylamino)ethyl]phenyl]piperidin-4-yl]methoxy]phenyl]propanoic acid;sulfane |
|---|---|
| PubChem CID | 161387227 |
| Molecular Formula | C30H36F8N2O4S |
| Molecular Weight | 672.68 g/mol |
| Exact Mass | 672.23 |
| IUPAC Name | (3S)-3-cyclopropyl-3-[3-[[1-[5-methoxy-2-[2,2,2-trifluoro-1-(2,2,3,3,3-pentafluoropropylamino)ethyl]phenyl]piperidin-4-yl]methoxy]phenyl]propanoic acid;sulfane |
| SMILES | COc1ccc(C(NCC(F)(F)C(F)(F)F)C(F)(F)F)c(N2CCC(COc3cccc([C@@H](CC(=O)O)C4CC4)c3)CC2)c1.S |
| InChI | InChI=1S/C30H34F8N2O4.H2S/c1-43-21-7-8-23(27(29(33,34)35)39-17-28(31,32)30(36,37)38)25(14-21)40-11-9-18(10-12-40)16-44-22-4-2-3-20(13-22)24(15-26(41)42)19-5-6-19;/h2-4,7-8,13-14,18-19,24,27,39H,5-6,9-12,15-17H2,1H3,(H,41,42);1H2/t24-,27?;/m0./s1 |
| InChIKey | VSMWBWJJYASDDY-IPYZQGFGSA-N |
| XLogP | 7.46 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.68 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|