C29H29N9O6 — CID 146315824
1-[(E)-4-[(4-carbamoyl-6-nitro-1-benzofuran-7-yl)amino]but-2-enyl]-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-7-methylbenzimidazole-5-carboxamide (PubChem CID 146315824) has the molecular formula C29H29N9O6 and a molecular weight of 599.61 g/mol. Its IUPAC name is 1-[(E)-4-[(4-carbamoyl-6-nitro-1-benzofuran-7-yl)amino]but-2-enyl]-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-7-methylbenzimidazole-5-carboxamide.
| Compound Name | 1-[(E)-4-[(4-carbamoyl-6-nitro-1-benzofuran-7-yl)amino]but-2-enyl]-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-7-methylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 146315824 |
| Molecular Formula | C29H29N9O6 |
| Molecular Weight | 599.61 g/mol |
| Exact Mass | 599.22 |
| IUPAC Name | 1-[(E)-4-[(4-carbamoyl-6-nitro-1-benzofuran-7-yl)amino]but-2-enyl]-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-7-methylbenzimidazole-5-carboxamide |
| SMILES | CCn1nc(C)cc1C(=O)Nc1nc2cc(C(N)=O)cc(C)c2n1C/C=C/CNc1c([N+](=O)[O-])cc(C(N)=O)c2ccoc12 |
| InChI | InChI=1S/C29H29N9O6/c1-4-37-22(12-16(3)35-37)28(41)34-29-33-20-13-17(26(30)39)11-15(2)24(20)36(29)9-6-5-8-32-23-21(38(42)43)14-19(27(31)40)18-7-10-44-25(18)23/h5-7,10-14,32H,4,8-9H2,1-3H3,(H2,30,39)(H2,31,40)(H,33,34,41)/b6-5+ |
| InChIKey | AKXOOPRPKNRSBS-AATRIKPKSA-N |
| XLogP | 3.64 |
| TPSA | 219.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.61 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|