C17H18FNO3 — CID 146316512
N-[(2-fluorophenyl)methyl]-2,4-dihydroxy-5-propan-2-ylbenzamide (PubChem CID 146316512) has the molecular formula C17H18FNO3 and a molecular weight of 303.33 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-2,4-dihydroxy-5-propan-2-ylbenzamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-2,4-dihydroxy-5-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 146316512 |
| Molecular Formula | C17H18FNO3 |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-2,4-dihydroxy-5-propan-2-ylbenzamide |
| SMILES | CC(C)c1cc(C(=O)NCc2ccccc2F)c(O)cc1O |
| InChI | InChI=1S/C17H18FNO3/c1-10(2)12-7-13(16(21)8-15(12)20)17(22)19-9-11-5-3-4-6-14(11)18/h3-8,10,20-21H,9H2,1-2H3,(H,19,22) |
| InChIKey | APMKRSYXKMHKMU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |