C16H26N2O5 — CID 146316609
2-[3-[4-(dimethoxymethyl)piperidin-1-yl]-1,2-oxazol-5-yl]-3-methylbutanoic acid (PubChem CID 146316609) has the molecular formula C16H26N2O5 and a molecular weight of 326.39 g/mol. Its IUPAC name is 2-[3-[4-(dimethoxymethyl)piperidin-1-yl]-1,2-oxazol-5-yl]-3-methylbutanoic acid.
| Compound Name | 2-[3-[4-(dimethoxymethyl)piperidin-1-yl]-1,2-oxazol-5-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 146316609 |
| Molecular Formula | C16H26N2O5 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 2-[3-[4-(dimethoxymethyl)piperidin-1-yl]-1,2-oxazol-5-yl]-3-methylbutanoic acid |
| SMILES | COC(OC)C1CCN(c2cc(C(C(=O)O)C(C)C)on2)CC1 |
| InChI | InChI=1S/C16H26N2O5/c1-10(2)14(15(19)20)12-9-13(17-23-12)18-7-5-11(6-8-18)16(21-3)22-4/h9-11,14,16H,5-8H2,1-4H3,(H,19,20) |
| InChIKey | SZCLBQZSRLOXKJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 85.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|