C9H11N3O8 — CID 146316941
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-nitropyrimidine-2,4-dione (PubChem CID 146316941) has the molecular formula C9H11N3O8 and a molecular weight of 289.20 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-nitropyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-nitropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 146316941 |
| Molecular Formula | C9H11N3O8 |
| Molecular Weight | 289.20 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-nitropyrimidine-2,4-dione |
| SMILES | O=c1cc([N+](=O)[O-])n([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C9H11N3O8/c13-2-3-6(15)7(16)8(20-3)11-5(12(18)19)1-4(14)10-9(11)17/h1,3,6-8,13,15-16H,2H2,(H,10,14,17)/t3-,6-,7-,8-/m1/s1 |
| InChIKey | PZONZQRTGFJPCQ-YXZULKJRSA-N |
| XLogP | -2.94 |
| TPSA | 167.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.20 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|