C10H13N3O5 — CID 23259432
(2R,4R,5S,6S)-5-hydroxy-4-(hydroxymethyl)-7-methyl-3-oxa-1,7,11-triazatricyclo[6.4.0.02,6]dodec-8-ene-10,12-dione (PubChem CID 23259432) has the molecular formula C10H13N3O5 and a molecular weight of 255.23 g/mol. Its IUPAC name is (2R,4R,5S,6S)-5-hydroxy-4-(hydroxymethyl)-7-methyl-3-oxa-1,7,11-triazatricyclo[6.4.0.02,6]dodec-8-ene-10,12-dione.
| Compound Name | (2R,4R,5S,6S)-5-hydroxy-4-(hydroxymethyl)-7-methyl-3-oxa-1,7,11-triazatricyclo[6.4.0.02,6]dodec-8-ene-10,12-dione |
|---|---|
| PubChem CID | 23259432 |
| Molecular Formula | C10H13N3O5 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | (2R,4R,5S,6S)-5-hydroxy-4-(hydroxymethyl)-7-methyl-3-oxa-1,7,11-triazatricyclo[6.4.0.02,6]dodec-8-ene-10,12-dione |
| SMILES | CN1c2cc(=O)[nH]c(=O)n2[C@@H]2O[C@H](CO)[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C10H13N3O5/c1-12-6-2-5(15)11-10(17)13(6)9-7(12)8(16)4(3-14)18-9/h2,4,7-9,14,16H,3H2,1H3,(H,11,15,17)/t4-,7+,8-,9-/m1/s1 |
| InChIKey | SJXMDIUODLGPBU-CNOPELTASA-N |
| XLogP | -2.39 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |