C19H20FNO2 — CID 146318432
6-fluoro-4-[[(1R,5S)-6-[(Z)-1-methoxyprop-1-en-2-yl]-3-bicyclo[3.1.0]hexanyl]oxy]quinoline (PubChem CID 146318432) has the molecular formula C19H20FNO2 and a molecular weight of 313.37 g/mol. Its IUPAC name is 6-fluoro-4-[[(1R,5S)-6-[(Z)-1-methoxyprop-1-en-2-yl]-3-bicyclo[3.1.0]hexanyl]oxy]quinoline.
| Compound Name | 6-fluoro-4-[[(1R,5S)-6-[(Z)-1-methoxyprop-1-en-2-yl]-3-bicyclo[3.1.0]hexanyl]oxy]quinoline |
|---|---|
| PubChem CID | 146318432 |
| Molecular Formula | C19H20FNO2 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 6-fluoro-4-[[(1R,5S)-6-[(Z)-1-methoxyprop-1-en-2-yl]-3-bicyclo[3.1.0]hexanyl]oxy]quinoline |
| SMILES | CO/C=C(/C)C1[C@H]2CC(Oc3ccnc4ccc(F)cc34)C[C@@H]12 |
| InChI | InChI=1S/C19H20FNO2/c1-11(10-22-2)19-14-8-13(9-15(14)19)23-18-5-6-21-17-4-3-12(20)7-16(17)18/h3-7,10,13-15,19H,8-9H2,1-2H3/b11-10-/t13?,14-,15+,19? |
| InChIKey | RJDQEYBJDMNFRX-BOCVQIAZSA-N |
| XLogP | 4.33 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|