C20H24FNO2 — CID 153395551
4-[2-[(2R,3S)-2-ethyl-3-[(Z)-1-methoxyprop-1-en-2-yl]cyclopropyl]ethoxy]-6-fluoroquinoline (PubChem CID 153395551) has the molecular formula C20H24FNO2 and a molecular weight of 329.42 g/mol. Its IUPAC name is 4-[2-[(2R,3S)-2-ethyl-3-[(Z)-1-methoxyprop-1-en-2-yl]cyclopropyl]ethoxy]-6-fluoroquinoline.
| Compound Name | 4-[2-[(2R,3S)-2-ethyl-3-[(Z)-1-methoxyprop-1-en-2-yl]cyclopropyl]ethoxy]-6-fluoroquinoline |
|---|---|
| PubChem CID | 153395551 |
| Molecular Formula | C20H24FNO2 |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | 4-[2-[(2R,3S)-2-ethyl-3-[(Z)-1-methoxyprop-1-en-2-yl]cyclopropyl]ethoxy]-6-fluoroquinoline |
| SMILES | CC[C@@H]1C(CCOc2ccnc3ccc(F)cc23)[C@H]1/C(C)=C\OC |
| InChI | InChI=1S/C20H24FNO2/c1-4-15-16(20(15)13(2)12-23-3)8-10-24-19-7-9-22-18-6-5-14(21)11-17(18)19/h5-7,9,11-12,15-16,20H,4,8,10H2,1-3H3/b13-12-/t15-,16?,20+/m1/s1 |
| InChIKey | XKISHNJQBSJLKP-UGWIHEDLSA-N |
| XLogP | 4.97 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|