C18H21FN2O2 — CID 175115794
[1-(6-fluoroquinolin-4-yl)piperidin-4-yl] butanoate (PubChem CID 175115794) has the molecular formula C18H21FN2O2 and a molecular weight of 316.38 g/mol. Its IUPAC name is [1-(6-fluoroquinolin-4-yl)piperidin-4-yl] butanoate.
| Compound Name | [1-(6-fluoroquinolin-4-yl)piperidin-4-yl] butanoate |
|---|---|
| PubChem CID | 175115794 |
| Molecular Formula | C18H21FN2O2 |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | [1-(6-fluoroquinolin-4-yl)piperidin-4-yl] butanoate |
| SMILES | CCCC(=O)OC1CCN(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C18H21FN2O2/c1-2-3-18(22)23-14-7-10-21(11-8-14)17-6-9-20-16-5-4-13(19)12-15(16)17/h4-6,9,12,14H,2-3,7-8,10-11H2,1H3 |
| InChIKey | ZTXWFOTUFAISJV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |