C23H28FN5O — CID 91952370
N-[3-(2-ethylimidazol-1-yl)propyl]-1-(6-fluoroquinolin-4-yl)piperidine-4-carboxamide (PubChem CID 91952370) has the molecular formula C23H28FN5O and a molecular weight of 409.51 g/mol. Its IUPAC name is N-[3-(2-ethylimidazol-1-yl)propyl]-1-(6-fluoroquinolin-4-yl)piperidine-4-carboxamide.
| Compound Name | N-[3-(2-ethylimidazol-1-yl)propyl]-1-(6-fluoroquinolin-4-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 91952370 |
| Molecular Formula | C23H28FN5O |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | N-[3-(2-ethylimidazol-1-yl)propyl]-1-(6-fluoroquinolin-4-yl)piperidine-4-carboxamide |
| SMILES | CCc1nccn1CCCNC(=O)C1CCN(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C23H28FN5O/c1-2-22-26-11-15-29(22)12-3-9-27-23(30)17-7-13-28(14-8-17)21-6-10-25-20-5-4-18(24)16-19(20)21/h4-6,10-11,15-17H,2-3,7-9,12-14H2,1H3,(H,27,30) |
| InChIKey | IODJTFWOSMDRKB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|